C19H21N3O5S — CID 4014323
methyl 2-[4-[[(3,5-dimethoxybenzoyl)amino]carbamothioylamino]phenyl]acetate (PubChem CID 4014323) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl 2-[4-[[(3,5-dimethoxybenzoyl)amino]carbamothioylamino]phenyl]acetate.
| Compound Name | methyl 2-[4-[[(3,5-dimethoxybenzoyl)amino]carbamothioylamino]phenyl]acetate |
|---|---|
| PubChem CID | 4014323 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | methyl 2-[4-[[(3,5-dimethoxybenzoyl)amino]carbamothioylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(=S)NNC(=O)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C19H21N3O5S/c1-25-15-9-13(10-16(11-15)26-2)18(24)21-22-19(28)20-14-6-4-12(5-7-14)8-17(23)27-3/h4-7,9-11H,8H2,1-3H3,(H,21,24)(H2,20,22,28) |
| InChIKey | DJEIVAPODJRBEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|