C24H18N4O2 — CID 4023231
3-[(1-benzylindol-3-yl)methylideneamino]-1H-quinazoline-2,4-dione (PubChem CID 4023231) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-[(1-benzylindol-3-yl)methylideneamino]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(1-benzylindol-3-yl)methylideneamino]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4023231 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-[(1-benzylindol-3-yl)methylideneamino]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1N=Cc1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C24H18N4O2/c29-23-20-11-4-6-12-21(20)26-24(30)28(23)25-14-18-16-27(15-17-8-2-1-3-9-17)22-13-7-5-10-19(18)22/h1-14,16H,15H2,(H,26,30) |
| InChIKey | XMKFYESBXSSFPF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|