About Benzoxazole, 2-amino-6-chloro-
Benzoxazole, 2-amino-6-chloro- (PubChem CID 40237) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 6-chloro-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | Benzoxazole, 2-amino-6-chloro- |
| PubChem CID | 40237 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 6-chloro-1,3-benzoxazol-2-amine |
| SMILES | C1=CC2=C(C=C1Cl)OC(=N2)N |
| InChI | InChI=1S/C7H5ClN2O/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10) |
| InChIKey | QDMXVLGVKMTTIT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 155 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Benzoxazole, 2-amino-6-chloro- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzoxazole, 2-amino-6-chloro-?
The IUPAC name of Benzoxazole, 2-amino-6-chloro- (CID 40237) is 6-chloro-1,3-benzoxazol-2-amine.
What is the SMILES notation for Benzoxazole, 2-amino-6-chloro-?
The canonical SMILES for Benzoxazole, 2-amino-6-chloro- is C1=CC2=C(C=C1Cl)OC(=N2)N.
What is the InChIKey of Benzoxazole, 2-amino-6-chloro-?
The InChIKey is QDMXVLGVKMTTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10).
What are the key properties of Benzoxazole, 2-amino-6-chloro-?
Benzoxazole, 2-amino-6-chloro- has a molecular weight of 168.58 g/mol, XLogP of 2.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Benzoxazole, 2-amino-6-chloro- is sourced from PubChem (CID 40237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).