C13H23N3O4S — CID 4024276
3-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoyl]-1-methyl-1-methylsulfonylurea (PubChem CID 4024276) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoyl]-1-methyl-1-methylsulfonylurea.
| Compound Name | 3-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoyl]-1-methyl-1-methylsulfonylurea |
|---|---|
| PubChem CID | 4024276 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoyl]-1-methyl-1-methylsulfonylurea |
| SMILES | CC(NC(=O)NC(=O)N(C)S(C)(=O)=O)C1CC2CCC1C2 |
| InChI | InChI=1S/C13H23N3O4S/c1-8(11-7-9-4-5-10(11)6-9)14-12(17)15-13(18)16(2)21(3,19)20/h8-11H,4-7H2,1-3H3,(H2,14,15,17,18) |
| InChIKey | VENONHNXWCTABZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |