C15H12N2O5 — CID 4025868
[3-(1,2-oxazol-3-yl)-4-oxochromen-7-yl] 2-aminopropanoate (PubChem CID 4025868) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is [3-(1,2-oxazol-3-yl)-4-oxochromen-7-yl] 2-aminopropanoate.
| Compound Name | [3-(1,2-oxazol-3-yl)-4-oxochromen-7-yl] 2-aminopropanoate |
|---|---|
| PubChem CID | 4025868 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [3-(1,2-oxazol-3-yl)-4-oxochromen-7-yl] 2-aminopropanoate |
| SMILES | CC(N)C(=O)Oc1ccc2c(=O)c(-c3ccon3)coc2c1 |
| InChI | InChI=1S/C15H12N2O5/c1-8(16)15(19)22-9-2-3-10-13(6-9)20-7-11(14(10)18)12-4-5-21-17-12/h2-8H,16H2,1H3 |
| InChIKey | HEFPFOYYWGVOSC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|