C14H10Cl2NO2- — CID 4036
2-[(2,6-Dichloro-3-methylphenyl)amino]benzoate (PubChem CID 4036) has the molecular formula C14H10Cl2NO2- and a molecular weight of 295.10 g/mol. Its IUPAC name is 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | 2-[(2,6-Dichloro-3-methylphenyl)amino]benzoate |
|---|---|
| PubChem CID | 4036 |
| Molecular Formula | C14H10Cl2NO2- |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | CC1=C(C(=C(C=C1)Cl)NC2=CC=CC=C2C(=O)[O-])Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19)/p-1 |
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-M |
| XLogP | 5.80 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | 321 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |