C18H12F2N2O5S — CID 4044245
N-(2,4-difluorophenyl)-2-[5-[(3,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 4044245) has the molecular formula C18H12F2N2O5S and a molecular weight of 406.37 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[5-[(3,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[5-[(3,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 4044245 |
| Molecular Formula | C18H12F2N2O5S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[5-[(3,4-dihydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(O)c(O)c2)C1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H12F2N2O5S/c19-10-2-3-12(11(20)7-10)21-16(25)8-22-17(26)15(28-18(22)27)6-9-1-4-13(23)14(24)5-9/h1-7,23-24H,8H2,(H,21,25) |
| InChIKey | QKBIZMQWTMDARW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|