C22H19ClN2O — CID 4044354
3-(4-chlorophenyl)-2-(1-phenylethyl)-1,2-dihydroquinazolin-4-one (PubChem CID 4044354) has the molecular formula C22H19ClN2O and a molecular weight of 362.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(1-phenylethyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-(1-phenylethyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 4044354 |
| Molecular Formula | C22H19ClN2O |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(1-phenylethyl)-1,2-dihydroquinazolin-4-one |
| SMILES | CC(c1ccccc1)C1Nc2ccccc2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O/c1-15(16-7-3-2-4-8-16)21-24-20-10-6-5-9-19(20)22(26)25(21)18-13-11-17(23)12-14-18/h2-15,21,24H,1H3 |
| InChIKey | PICLVTIVPWKLBJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |