C23H27N3O4 — CID 4047900
4-hydroxy-3-(3-methoxyphenyl)-N-(2-methylcyclohexyl)-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 4047900) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-hydroxy-3-(3-methoxyphenyl)-N-(2-methylcyclohexyl)-2-oxo-1H-quinazoline-4-carboxamide.
| Compound Name | 4-hydroxy-3-(3-methoxyphenyl)-N-(2-methylcyclohexyl)-2-oxo-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 4047900 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-hydroxy-3-(3-methoxyphenyl)-N-(2-methylcyclohexyl)-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | COc1cccc(N2C(=O)Nc3ccccc3C2(O)C(=O)NC2CCCCC2C)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-15-8-3-5-12-19(15)24-21(27)23(29)18-11-4-6-13-20(18)25-22(28)26(23)16-9-7-10-17(14-16)30-2/h4,6-7,9-11,13-15,19,29H,3,5,8,12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | LWARLWXGJKLYNO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |