C26H34N4O5 — CID 93156073
(4R)-3-(2,4-dimethoxyphenyl)-4-hydroxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 93156073) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is (4R)-3-(2,4-dimethoxyphenyl)-4-hydroxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-2-oxo-1H-quinazoline-4-carboxamide.
| Compound Name | (4R)-3-(2,4-dimethoxyphenyl)-4-hydroxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-2-oxo-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 93156073 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (4R)-3-(2,4-dimethoxyphenyl)-4-hydroxy-N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | COc1ccc(N2C(=O)Nc3ccccc3[C@@]2(O)C(=O)NCCCN2CCC[C@H](C)C2)c(OC)c1 |
| InChI | InChI=1S/C26H34N4O5/c1-18-8-6-14-29(17-18)15-7-13-27-24(31)26(33)20-9-4-5-10-21(20)28-25(32)30(26)22-12-11-19(34-2)16-23(22)35-3/h4-5,9-12,16,18,33H,6-8,13-15,17H2,1-3H3,(H,27,31)(H,28,32)/t18-,26+/m0/s1 |
| InChIKey | RQAWQWQBSPHELC-HFJWLAOPSA-N |
| XLogP | 3.14 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|