C23H28N4O5 — CID 92653839
(4R)-4-hydroxy-3-(3-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 92653839) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (4R)-4-hydroxy-3-(3-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-2-oxo-1H-quinazoline-4-carboxamide.
| Compound Name | (4R)-4-hydroxy-3-(3-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-2-oxo-1H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 92653839 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (4R)-4-hydroxy-3-(3-methoxyphenyl)-N-(3-morpholin-4-ylpropyl)-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | COc1cccc(N2C(=O)Nc3ccccc3[C@@]2(O)C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C23H28N4O5/c1-31-18-7-4-6-17(16-18)27-22(29)25-20-9-3-2-8-19(20)23(27,30)21(28)24-10-5-11-26-12-14-32-15-13-26/h2-4,6-9,16,30H,5,10-15H2,1H3,(H,24,28)(H,25,29)/t23-/m1/s1 |
| InChIKey | NNTPGKNNWWTCDH-HSZRJFAPSA-N |
| XLogP | 1.73 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|