C26H27ClN2O4S — CID 4048482
3-(butanoylamino)-4-(4-chlorophenyl)sulfonyl-N-[2-(4-methylphenyl)ethyl]benzamide (PubChem CID 4048482) has the molecular formula C26H27ClN2O4S and a molecular weight of 499.03 g/mol. Its IUPAC name is 3-(butanoylamino)-4-(4-chlorophenyl)sulfonyl-N-[2-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 3-(butanoylamino)-4-(4-chlorophenyl)sulfonyl-N-[2-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 4048482 |
| Molecular Formula | C26H27ClN2O4S |
| Molecular Weight | 499.03 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 3-(butanoylamino)-4-(4-chlorophenyl)sulfonyl-N-[2-(4-methylphenyl)ethyl]benzamide |
| SMILES | CCCC(=O)Nc1cc(C(=O)NCCc2ccc(C)cc2)ccc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN2O4S/c1-3-4-25(30)29-23-17-20(26(31)28-16-15-19-7-5-18(2)6-8-19)9-14-24(23)34(32,33)22-12-10-21(27)11-13-22/h5-14,17H,3-4,15-16H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | USCSULKCIYCPNZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.03 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |