C18H12ClN5O3 — CID 40508023
1-(4-chlorophenyl)-5-[(3-nitrophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 40508023) has the molecular formula C18H12ClN5O3 and a molecular weight of 381.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(3-nitrophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(4-chlorophenyl)-5-[(3-nitrophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 40508023 |
| Molecular Formula | C18H12ClN5O3 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(3-nitrophenyl)methyl]pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccc(Cl)cc3)c2ncn1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12ClN5O3/c19-13-4-6-14(7-5-13)23-17-16(9-21-23)18(25)22(11-20-17)10-12-2-1-3-15(8-12)24(26)27/h1-9,11H,10H2 |
| InChIKey | GWRMZVPCHJKWSN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|