C22H18Cl3N3O4 — CID 4050970
4-[[4-chloro-1-(3,4-dichlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4050970) has the molecular formula C22H18Cl3N3O4 and a molecular weight of 494.76 g/mol. Its IUPAC name is 4-[[4-chloro-1-(3,4-dichlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[4-chloro-1-(3,4-dichlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4050970 |
| Molecular Formula | C22H18Cl3N3O4 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-[[4-chloro-1-(3,4-dichlorophenyl)-2,5-dioxopyrrol-3-yl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(NC2=C(Cl)C(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H18Cl3N3O4/c23-16-8-7-14(10-17(16)24)28-21(30)18(25)19(22(28)31)27-13-5-3-12(4-6-13)20(29)26-11-15-2-1-9-32-15/h3-8,10,15,27H,1-2,9,11H2,(H,26,29) |
| InChIKey | OYAGABFWFOIPJR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|