C15H14Cl2N2O3 — CID 4124404
3-chloro-1-(4-chlorophenyl)-4-(oxolan-2-ylmethylamino)pyrrole-2,5-dione (PubChem CID 4124404) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 3-chloro-1-(4-chlorophenyl)-4-(oxolan-2-ylmethylamino)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(4-chlorophenyl)-4-(oxolan-2-ylmethylamino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 4124404 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-chloro-1-(4-chlorophenyl)-4-(oxolan-2-ylmethylamino)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(NCC2CCCO2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c16-9-3-5-10(6-4-9)19-14(20)12(17)13(15(19)21)18-8-11-2-1-7-22-11/h3-6,11,18H,1-2,7-8H2 |
| InChIKey | NSWZHOPFNSIYQQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|