C15H20N6O3 — CID 40509725
(4R)-3,4,7,9-tetramethyl-1-[(2R)-3-oxobutan-2-yl]-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 40509725) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (4R)-3,4,7,9-tetramethyl-1-[(2R)-3-oxobutan-2-yl]-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4R)-3,4,7,9-tetramethyl-1-[(2R)-3-oxobutan-2-yl]-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 40509725 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4R)-3,4,7,9-tetramethyl-1-[(2R)-3-oxobutan-2-yl]-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC(=O)[C@@H](C)N1N=C(C)[C@@H](C)n2c1nc1c2c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H20N6O3/c1-7-8(2)20-11-12(18(5)15(24)19(6)13(11)23)16-14(20)21(17-7)9(3)10(4)22/h8-9H,1-6H3/t8-,9-/m1/s1 |
| InChIKey | PMLJUAJBMCMKQJ-RKDXNWHRSA-N |
| XLogP | 0.17 |
| TPSA | 94.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |