C38H44F2N2O5 — CID 4051208
(3,4-difluorophenyl)-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4051208) has the molecular formula C38H44F2N2O5 and a molecular weight of 646.78 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4051208 |
| Molecular Formula | C38H44F2N2O5 |
| Molecular Weight | 646.78 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | (3,4-difluorophenyl)-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C38H44F2N2O5/c1-34-10-7-25(43)21-36(34)13-14-38(26(22-36)32(44)24-5-6-27(39)28(40)20-24)30(34)8-11-35(2)31(38)9-12-37(35,46)23-41-15-17-42(18-16-41)33(45)29-4-3-19-47-29/h3-6,13-14,19-20,22,25,30-31,43,46H,7-12,15-18,21,23H2,1-2H3 |
| InChIKey | RLXWQHIECGTQNZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.78 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|