C16H15NO2 — CID 40513894
(3R)-3-(2,5-dimethylanilino)-3H-2-benzofuran-1-one (PubChem CID 40513894) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3R)-3-(2,5-dimethylanilino)-3H-2-benzofuran-1-one.
| Compound Name | (3R)-3-(2,5-dimethylanilino)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 40513894 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (3R)-3-(2,5-dimethylanilino)-3H-2-benzofuran-1-one |
| SMILES | Cc1ccc(C)c(N[C@@H]2OC(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C16H15NO2/c1-10-7-8-11(2)14(9-10)17-15-12-5-3-4-6-13(12)16(18)19-15/h3-9,15,17H,1-2H3/t15-/m1/s1 |
| InChIKey | NWGPMEDSDOODQL-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |