C18H13N5O2S2 — CID 40517023
2-[5-(2,2-dicyanoethenyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanyl-N-(4-methoxyphenyl)acetamide (PubChem CID 40517023) has the molecular formula C18H13N5O2S2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[5-(2,2-dicyanoethenyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[5-(2,2-dicyanoethenyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 40517023 |
| Molecular Formula | C18H13N5O2S2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-[5-(2,2-dicyanoethenyl)imidazo[2,1-b][1,3]thiazol-6-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3sccn3c2C=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C18H13N5O2S2/c1-25-14-4-2-13(3-5-14)21-16(24)11-27-17-15(8-12(9-19)10-20)23-6-7-26-18(23)22-17/h2-8H,11H2,1H3,(H,21,24) |
| InChIKey | ZVSBDBHDDXEYMF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|