C16H15N3O2S2 — CID 40517031
N-(3,4-dimethylphenyl)-2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetamide (PubChem CID 40517031) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40517031 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3sccn3c2C=O)cc1C |
| InChI | InChI=1S/C16H15N3O2S2/c1-10-3-4-12(7-11(10)2)17-14(21)9-23-15-13(8-20)19-5-6-22-16(19)18-15/h3-8H,9H2,1-2H3,(H,17,21) |
| InChIKey | UGAKEBAEVRPYRA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|