C10H12N2O2S2 — CID 107772122
6-(3-hydroxybutan-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 107772122) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 6-(3-hydroxybutan-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(3-hydroxybutan-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 107772122 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 6-(3-hydroxybutan-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CC(O)C(C)Sc1nc2sccn2c1C=O |
| InChI | InChI=1S/C10H12N2O2S2/c1-6(14)7(2)16-9-8(5-13)12-3-4-15-10(12)11-9/h3-7,14H,1-2H3 |
| InChIKey | VDNIBEXQOJZQHF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|