C12H6Cl2N2OS2 — CID 63802182
6-(2,5-dichlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 63802182) has the molecular formula C12H6Cl2N2OS2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(2,5-dichlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63802182 |
| Molecular Formula | C12H6Cl2N2OS2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 6-(2,5-dichlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(Sc2cc(Cl)ccc2Cl)nc2sccn12 |
| InChI | InChI=1S/C12H6Cl2N2OS2/c13-7-1-2-8(14)10(5-7)19-11-9(6-17)16-3-4-18-12(16)15-11/h1-6H |
| InChIKey | FCIVBNFOQLWQNV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|