C12H6F2N2O2S — CID 43554836
6-(3,4-difluorophenoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 43554836) has the molecular formula C12H6F2N2O2S and a molecular weight of 280.25 g/mol. Its IUPAC name is 6-(3,4-difluorophenoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(3,4-difluorophenoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 43554836 |
| Molecular Formula | C12H6F2N2O2S |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 6-(3,4-difluorophenoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(Oc2ccc(F)c(F)c2)nc2sccn12 |
| InChI | InChI=1S/C12H6F2N2O2S/c13-8-2-1-7(5-9(8)14)18-11-10(6-17)16-3-4-19-12(16)15-11/h1-6H |
| InChIKey | MQXVSWMFXMEHFC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|