C10H8N4O2S — CID 116792967
6-(1-methylpyrazol-4-yl)oxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 116792967) has the molecular formula C10H8N4O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)oxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(1-methylpyrazol-4-yl)oxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 116792967 |
| Molecular Formula | C10H8N4O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)oxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cn1cc(Oc2nc3sccn3c2C=O)cn1 |
| InChI | InChI=1S/C10H8N4O2S/c1-13-5-7(4-11-13)16-9-8(6-15)14-2-3-17-10(14)12-9/h2-6H,1H3 |
| InChIKey | NZHGVZHGGJRWGP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|