C13H9ClN2O2S — CID 16780516
6-[(4-chlorophenyl)methoxy]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 16780516) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methoxy]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-[(4-chlorophenyl)methoxy]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 16780516 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6-[(4-chlorophenyl)methoxy]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(OCc2ccc(Cl)cc2)nc2sccn12 |
| InChI | InChI=1S/C13H9ClN2O2S/c14-10-3-1-9(2-4-10)8-18-12-11(7-17)16-5-6-19-13(16)15-12/h1-7H,8H2 |
| InChIKey | GXZNENUDJZIOOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|