C11H14N2O2S — CID 112728119
6-pentoxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 112728119) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 6-pentoxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-pentoxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 112728119 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 6-pentoxyimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CCCCCOc1nc2sccn2c1C=O |
| InChI | InChI=1S/C11H14N2O2S/c1-2-3-4-6-15-10-9(8-14)13-5-7-16-11(13)12-10/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | UQOXPMQBRQCCDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|