C10H12N2O3S — CID 16780522
6-(2-ethoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 16780522) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 6-(2-ethoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(2-ethoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 16780522 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-(2-ethoxyethoxy)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CCOCCOc1nc2sccn2c1C=O |
| InChI | InChI=1S/C10H12N2O3S/c1-2-14-4-5-15-9-8(7-13)12-3-6-16-10(12)11-9/h3,6-7H,2,4-5H2,1H3 |
| InChIKey | VSLLGASLKZYLKO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|