C13H14FN3O2S — CID 40518548
1-[(3R)-1,1-dioxothiolan-3-yl]-4-(4-fluorophenyl)pyrazol-5-amine (PubChem CID 40518548) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-4-(4-fluorophenyl)pyrazol-5-amine.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-4-(4-fluorophenyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 40518548 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-4-(4-fluorophenyl)pyrazol-5-amine |
| SMILES | Nc1c(-c2ccc(F)cc2)cnn1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14FN3O2S/c14-10-3-1-9(2-4-10)12-7-16-17(13(12)15)11-5-6-20(18,19)8-11/h1-4,7,11H,5-6,8,15H2/t11-/m1/s1 |
| InChIKey | RADSAKICRZDORL-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |