C20H26N4O3S — CID 4052847
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]acetamide (PubChem CID 4052847) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 4052847 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]acetamide |
| SMILES | COc1cc(OC)nc(CSCCNC(=O)CN2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C20H26N4O3S/c1-26-19-11-20(27-2)23-17(22-19)14-28-10-8-21-18(25)13-24-9-7-15-5-3-4-6-16(15)12-24/h3-6,11H,7-10,12-14H2,1-2H3,(H,21,25) |
| InChIKey | ZFFMWRCQGDOQGK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|