C19H23N3O5 — CID 40528527
4-(dimethylamino)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-2-methoxy-5-nitrobenzamide (PubChem CID 40528527) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-2-methoxy-5-nitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 40528527 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-(dimethylamino)-N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-2-methoxy-5-nitrobenzamide |
| SMILES | COc1cc(N(C)C)c([N+](=O)[O-])cc1C(=O)N[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O5/c1-12(18(23)13-8-6-5-7-9-13)20-19(24)14-10-16(22(25)26)15(21(2)3)11-17(14)27-4/h5-12,18,23H,1-4H3,(H,20,24)/t12-,18-/m0/s1 |
| InChIKey | MWJFUQAQJFVIQZ-SGTLLEGYSA-N |
| XLogP | 2.52 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|