C17H27N4O4+ — CID 7390462
4-(dimethylamino)-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-methoxy-5-nitrobenzamide (PubChem CID 7390462) has the molecular formula C17H27N4O4+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-methoxy-5-nitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 7390462 |
| Molecular Formula | C17H27N4O4+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 4-(dimethylamino)-N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-methoxy-5-nitrobenzamide |
| SMILES | CC[NH+]1CCC[C@H]1CNC(=O)c1cc([N+](=O)[O-])c(N(C)C)cc1OC |
| InChI | InChI=1S/C17H26N4O4/c1-5-20-8-6-7-12(20)11-18-17(22)13-9-15(21(23)24)14(19(2)3)10-16(13)25-4/h9-10,12H,5-8,11H2,1-4H3,(H,18,22)/p+1/t12-/m0/s1 |
| InChIKey | AFNPLUMDSLEAPD-LBPRGKRZSA-O |
| XLogP | 0.47 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|