C20H24N6O8 — CID 3666858
4-(dimethylamino)-N-[2-(2,4-dinitroanilino)ethyl]-N-ethyl-2-methoxy-5-nitrobenzamide (PubChem CID 3666858) has the molecular formula C20H24N6O8 and a molecular weight of 476.45 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-(2,4-dinitroanilino)ethyl]-N-ethyl-2-methoxy-5-nitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[2-(2,4-dinitroanilino)ethyl]-N-ethyl-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 3666858 |
| Molecular Formula | C20H24N6O8 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 4-(dimethylamino)-N-[2-(2,4-dinitroanilino)ethyl]-N-ethyl-2-methoxy-5-nitrobenzamide |
| SMILES | CCN(CCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)c1cc([N+](=O)[O-])c(N(C)C)cc1OC |
| InChI | InChI=1S/C20H24N6O8/c1-5-23(9-8-21-15-7-6-13(24(28)29)10-16(15)25(30)31)20(27)14-11-18(26(32)33)17(22(2)3)12-19(14)34-4/h6-7,10-12,21H,5,8-9H2,1-4H3 |
| InChIKey | OAIOWFBFRTXBER-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 174.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|