C17H25N3O6S — CID 92951004
N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-5-ethylsulfonyl-2-methoxy-4-nitrobenzamide (PubChem CID 92951004) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-5-ethylsulfonyl-2-methoxy-4-nitrobenzamide.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-5-ethylsulfonyl-2-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 92951004 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-5-ethylsulfonyl-2-methoxy-4-nitrobenzamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1cc(S(=O)(=O)CC)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H25N3O6S/c1-4-19-8-6-7-12(19)11-18-17(21)13-9-16(27(24,25)5-2)14(20(22)23)10-15(13)26-3/h9-10,12H,4-8,11H2,1-3H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | AHGRUFWMUYBFSG-GFCCVEGCSA-N |
| XLogP | 1.61 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|