C34H54N6O8S2 — CID 158713360
4-amino-N-[(2-ethylpyrrolidin-1-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide (PubChem CID 158713360) has the molecular formula C34H54N6O8S2 and a molecular weight of 738.97 g/mol. Its IUPAC name is 4-amino-N-[(2-ethylpyrrolidin-1-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide.
| Compound Name | 4-amino-N-[(2-ethylpyrrolidin-1-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 158713360 |
| Molecular Formula | C34H54N6O8S2 |
| Molecular Weight | 738.97 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | 4-amino-N-[(2-ethylpyrrolidin-1-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide |
| SMILES | CCC1CCCN1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC.CCC1CCCN1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC |
| InChI | InChI=1S/2C17H27N3O4S/c2*1-4-12-7-6-8-20(12)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3/h2*9-10,12H,4-8,11,18H2,1-3H3,(H,19,21) |
| InChIKey | IIZSKCCTXHITGB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 203.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|