C17H28N3O5S+ — CID 166157651
4-amino-N-[[(2R)-1-ethyl-1-hydroxypyrrolidin-1-ium-2-yl]methyl]-5-ethylsulfonyl-2-methoxybenzamide (PubChem CID 166157651) has the molecular formula C17H28N3O5S+ and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-amino-N-[[(2R)-1-ethyl-1-hydroxypyrrolidin-1-ium-2-yl]methyl]-5-ethylsulfonyl-2-methoxybenzamide.
| Compound Name | 4-amino-N-[[(2R)-1-ethyl-1-hydroxypyrrolidin-1-ium-2-yl]methyl]-5-ethylsulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 166157651 |
| Molecular Formula | C17H28N3O5S+ |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-amino-N-[[(2R)-1-ethyl-1-hydroxypyrrolidin-1-ium-2-yl]methyl]-5-ethylsulfonyl-2-methoxybenzamide |
| SMILES | CC[N+]1(O)CCC[C@@H]1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC |
| InChI | InChI=1S/C17H27N3O5S/c1-4-20(22)8-6-7-12(20)11-19-17(21)13-9-16(26(23,24)5-2)14(18)10-15(13)25-3/h9-10,12,22H,4-8,11H2,1-3H3,(H2-,18,19,21)/p+1/t12-,20?/m1/s1 |
| InChIKey | KCTVEOXFQSVRDI-ZRIYNBNISA-O |
| XLogP | 1.19 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|