C16H24BrClN2O3 — CID 138398931
2-chloro-4-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methylcarbamoyl]-5-methoxyphenolate;hydrobromide (PubChem CID 138398931) has the molecular formula C16H24BrClN2O3 and a molecular weight of 407.74 g/mol. Its IUPAC name is 2-chloro-4-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methylcarbamoyl]-5-methoxyphenolate;hydrobromide.
| Compound Name | 2-chloro-4-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methylcarbamoyl]-5-methoxyphenolate;hydrobromide |
|---|---|
| PubChem CID | 138398931 |
| Molecular Formula | C16H24BrClN2O3 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-chloro-4-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methylcarbamoyl]-5-methoxyphenolate;hydrobromide |
| SMILES | Br.CC[N+]1(C)CCCC1CNC(=O)c1cc(Cl)c([O-])cc1OC |
| InChI | InChI=1S/C16H23ClN2O3.BrH/c1-4-19(2)7-5-6-11(19)10-18-16(21)12-8-13(17)14(20)9-15(12)22-3;/h8-9,11H,4-7,10H2,1-3H3,(H-,18,20,21);1H |
| InChIKey | ZSFNTERQOJPYJW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|