C21H38N8O4S — CID 176531935
4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide;2-carbamimidoyl-1,1-dimethylguanidine (PubChem CID 176531935) has the molecular formula C21H38N8O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide;2-carbamimidoyl-1,1-dimethylguanidine.
| Compound Name | 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide;2-carbamimidoyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 176531935 |
| Molecular Formula | C21H38N8O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 4-amino-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide;2-carbamimidoyl-1,1-dimethylguanidine |
| SMILES | CCN1CCCC1CNC(=O)c1cc(S(=O)(=O)CC)c(N)cc1OC.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C17H27N3O4S.C4H11N5/c1-4-20-8-6-7-12(20)11-19-17(21)13-9-16(25(22,23)5-2)14(18)10-15(13)24-3;1-9(2)4(7)8-3(5)6/h9-10,12H,4-8,11,18H2,1-3H3,(H,19,21);1-2H3,(H5,5,6,7,8) |
| InChIKey | WHHPEVAMXPYXTP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 193.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|