C19H31N3O4S — CID 134543671
4-(ethylamino)-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide (PubChem CID 134543671) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is 4-(ethylamino)-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide.
| Compound Name | 4-(ethylamino)-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 134543671 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-(ethylamino)-N-[(1-ethylpyrrolidin-2-yl)methyl]-5-ethylsulfonyl-2-methoxybenzamide |
| SMILES | CCNc1cc(OC)c(C(=O)NCC2CCCN2CC)cc1S(=O)(=O)CC |
| InChI | InChI=1S/C19H31N3O4S/c1-5-20-16-12-17(26-4)15(11-18(16)27(24,25)7-3)19(23)21-13-14-9-8-10-22(14)6-2/h11-12,14,20H,5-10,13H2,1-4H3,(H,21,23) |
| InChIKey | XJHIORLAFZIXLS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |