C19H22N2O6S — CID 97063277
N-[(2S,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]-4-methoxy-5-methylsulfanyl-2-nitrobenzamide (PubChem CID 97063277) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[(2S,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]-4-methoxy-5-methylsulfanyl-2-nitrobenzamide.
| Compound Name | N-[(2S,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]-4-methoxy-5-methylsulfanyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 97063277 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[(2S,4S)-1,4-dihydroxy-4-phenylbutan-2-yl]-4-methoxy-5-methylsulfanyl-2-nitrobenzamide |
| SMILES | COc1cc([N+](=O)[O-])c(C(=O)N[C@H](CO)C[C@H](O)c2ccccc2)cc1SC |
| InChI | InChI=1S/C19H22N2O6S/c1-27-17-10-15(21(25)26)14(9-18(17)28-2)19(24)20-13(11-22)8-16(23)12-6-4-3-5-7-12/h3-7,9-10,13,16,22-23H,8,11H2,1-2H3,(H,20,24)/t13-,16-/m0/s1 |
| InChIKey | PLTJKMNEJPRJCX-BBRMVZONSA-N |
| XLogP | 2.54 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|