About (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine
(4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 40531190) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
Analyze (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine (CID 40531190) is (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is C[C@@H]1N=C(N)S[C@H]1C.
What is the InChIKey of (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is UFIVPTJXTHOMKS-IMJSIDKUSA-N. The full InChI is InChI=1S/C5H10N2S/c1-3-4(2)8-5(6)7-3/h3-4H,1-2H3,(H2,6,7)/t3-,4-/m0/s1.
What are the key properties of (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine?
(4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 130.22 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dimethyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 40531190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).