C20H42ClNO2 — CID 40535198
N-butyl-N-[2-[2-[(2R)-1-chlorooctan-2-yl]oxyethoxy]ethyl]butan-1-amine (PubChem CID 40535198) has the molecular formula C20H42ClNO2 and a molecular weight of 364.01 g/mol. Its IUPAC name is N-butyl-N-[2-[2-[(2R)-1-chlorooctan-2-yl]oxyethoxy]ethyl]butan-1-amine.
| Compound Name | N-butyl-N-[2-[2-[(2R)-1-chlorooctan-2-yl]oxyethoxy]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 40535198 |
| Molecular Formula | C20H42ClNO2 |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | N-butyl-N-[2-[2-[(2R)-1-chlorooctan-2-yl]oxyethoxy]ethyl]butan-1-amine |
| SMILES | CCCCCC[C@H](CCl)OCCOCCN(CCCC)CCCC |
| InChI | InChI=1S/C20H42ClNO2/c1-4-7-10-11-12-20(19-21)24-18-17-23-16-15-22(13-8-5-2)14-9-6-3/h20H,4-19H2,1-3H3/t20-/m1/s1 |
| InChIKey | JWXHWKFPDBBDFK-HXUWFJFHSA-N |
| XLogP | 5.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|