C21H30N2O2S — CID 40541444
(4aR,8aR)-8a-hydroxy-1-[(2-methoxyphenyl)methyl]spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione (PubChem CID 40541444) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is (4aR,8aR)-8a-hydroxy-1-[(2-methoxyphenyl)methyl]spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione.
| Compound Name | (4aR,8aR)-8a-hydroxy-1-[(2-methoxyphenyl)methyl]spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 40541444 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (4aR,8aR)-8a-hydroxy-1-[(2-methoxyphenyl)methyl]spiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
| SMILES | COc1ccccc1CN1C(=S)NC2(CCCCC2)[C@H]2CCCC[C@@]21O |
| InChI | InChI=1S/C21H30N2O2S/c1-25-17-10-4-3-9-16(17)15-23-19(26)22-20(12-6-2-7-13-20)18-11-5-8-14-21(18,23)24/h3-4,9-10,18,24H,2,5-8,11-15H2,1H3,(H,22,26)/t18-,21-/m1/s1 |
| InChIKey | LUHWLWQMBLLLGE-WIYYLYMNSA-N |
| XLogP | 3.97 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|