C22H32N2O3S — CID 40541414
(4aS,8aR)-1-[(2,3-dimethoxyphenyl)methyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione (PubChem CID 40541414) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is (4aS,8aR)-1-[(2,3-dimethoxyphenyl)methyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione.
| Compound Name | (4aS,8aR)-1-[(2,3-dimethoxyphenyl)methyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 40541414 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (4aS,8aR)-1-[(2,3-dimethoxyphenyl)methyl]-8a-hydroxyspiro[3,4a,5,6,7,8-hexahydroquinazoline-4,1'-cyclohexane]-2-thione |
| SMILES | COc1cccc(CN2C(=S)NC3(CCCCC3)[C@@H]3CCCC[C@@]32O)c1OC |
| InChI | InChI=1S/C22H32N2O3S/c1-26-17-10-8-9-16(19(17)27-2)15-24-20(28)23-21(12-5-3-6-13-21)18-11-4-7-14-22(18,24)25/h8-10,18,25H,3-7,11-15H2,1-2H3,(H,23,28)/t18-,22+/m0/s1 |
| InChIKey | HZRCILZMCHDUTH-PGRDOPGGSA-N |
| XLogP | 3.98 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|