C18H17NO4 — CID 40542779
(NZ)-N-[[(1S,2S)-2-(1,3-benzodioxol-5-yl)cyclopropyl]-(4-methoxyphenyl)methylidene]hydroxylamine (PubChem CID 40542779) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (NZ)-N-[[(1S,2S)-2-(1,3-benzodioxol-5-yl)cyclopropyl]-(4-methoxyphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[(1S,2S)-2-(1,3-benzodioxol-5-yl)cyclopropyl]-(4-methoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 40542779 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (NZ)-N-[[(1S,2S)-2-(1,3-benzodioxol-5-yl)cyclopropyl]-(4-methoxyphenyl)methylidene]hydroxylamine |
| SMILES | COc1ccc(/C(=N\O)[C@H]2C[C@@H]2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-21-13-5-2-11(3-6-13)18(19-20)15-9-14(15)12-4-7-16-17(8-12)23-10-22-16/h2-8,14-15,20H,9-10H2,1H3/b19-18+/t14-,15+/m1/s1 |
| InChIKey | FQBOLMUTDDLPMN-YPWSZFOLSA-N |
| XLogP | 3.41 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|