C10H16N4OS2 — CID 40549322
(NE)-N-[(2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclooctylidene]hydroxylamine (PubChem CID 40549322) has the molecular formula C10H16N4OS2 and a molecular weight of 272.40 g/mol. Its IUPAC name is (NE)-N-[(2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclooctylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclooctylidene]hydroxylamine |
|---|---|
| PubChem CID | 40549322 |
| Molecular Formula | C10H16N4OS2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (NE)-N-[(2S)-2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclooctylidene]hydroxylamine |
| SMILES | Nc1nnc(S[C@H]2CCCCCC/C2=N\O)s1 |
| InChI | InChI=1S/C10H16N4OS2/c11-9-12-13-10(17-9)16-8-6-4-2-1-3-5-7(8)14-15/h8,15H,1-6H2,(H2,11,12)/b14-7+/t8-/m0/s1 |
| InChIKey | SSKHKBGEKZHAPB-QZNXTOQNSA-N |
| XLogP | 2.77 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|