C9H12N4OS2 — CID 98152194
(NZ)-N-[(1S,3S,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98152194) has the molecular formula C9H12N4OS2 and a molecular weight of 256.36 g/mol. Its IUPAC name is (NZ)-N-[(1S,3S,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3S,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98152194 |
| Molecular Formula | C9H12N4OS2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (NZ)-N-[(1S,3S,4R)-3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | Nc1nnc(S[C@@H]2/C(=N\O)[C@H]3CC[C@@H]2C3)s1 |
| InChI | InChI=1S/C9H12N4OS2/c10-8-11-12-9(16-8)15-7-5-2-1-4(3-5)6(7)13-14/h4-5,7,14H,1-3H2,(H2,10,11)/b13-6-/t4-,5+,7-/m0/s1 |
| InChIKey | KYFDZLFAMJLBDD-BAWSRKKZSA-N |
| XLogP | 1.84 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|