C11H15N5OS — CID 98152531
(NZ)-N-[(1S,3R,4S)-3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98152531) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,4S)-3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,4S)-3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98152531 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (NZ)-N-[(1S,3R,4S)-3-(4,6-diaminopyrimidin-2-yl)sulfanyl-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | Nc1cc(N)nc(S[C@H]2/C(=N\O)[C@H]3CC[C@H]2C3)n1 |
| InChI | InChI=1S/C11H15N5OS/c12-7-4-8(13)15-11(14-7)18-10-6-2-1-5(3-6)9(10)16-17/h4-6,10,17H,1-3H2,(H4,12,13,14,15)/b16-9-/t5-,6-,10+/m0/s1 |
| InChIKey | ZLASKWGKWNXUTG-WLGOSJOMSA-N |
| XLogP | 1.36 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|