C15H23N3O6S — CID 40557769
ethyl (3R,5S)-5-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]-3-(3-methoxy-3-oxopropyl)-5-methyl-2-oxooxolane-3-carboxylate (PubChem CID 40557769) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is ethyl (3R,5S)-5-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]-3-(3-methoxy-3-oxopropyl)-5-methyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,5S)-5-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]-3-(3-methoxy-3-oxopropyl)-5-methyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 40557769 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ethyl (3R,5S)-5-[(Z)-N-(carbamothioylamino)-C-methylcarbonimidoyl]-3-(3-methoxy-3-oxopropyl)-5-methyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCC(=O)OC)C[C@@](C)(/C(C)=N\NC(N)=S)OC1=O |
| InChI | InChI=1S/C15H23N3O6S/c1-5-23-11(20)15(7-6-10(19)22-4)8-14(3,24-12(15)21)9(2)17-18-13(16)25/h5-8H2,1-4H3,(H3,16,18,25)/b17-9-/t14-,15+/m0/s1 |
| InChIKey | XAXRRLALMWOGIE-LCNDUVFQSA-N |
| XLogP | 0.40 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|