C20H26Br3NO5S — CID 44661690
ethyl 5-[2-(3,5-dibromopyridin-1-ium-1-yl)sulfanylacetyl]-5-methyl-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate bromide (PubChem CID 44661690) has the molecular formula C20H26Br3NO5S and a molecular weight of 632.21 g/mol. Its IUPAC name is ethyl 5-[2-(3,5-dibromopyridin-1-ium-1-yl)sulfanylacetyl]-5-methyl-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate bromide.
| Compound Name | ethyl 5-[2-(3,5-dibromopyridin-1-ium-1-yl)sulfanylacetyl]-5-methyl-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate bromide |
|---|---|
| PubChem CID | 44661690 |
| Molecular Formula | C20H26Br3NO5S |
| Molecular Weight | 632.21 g/mol |
| Exact Mass | 628.91 |
| IUPAC Name | ethyl 5-[2-(3,5-dibromopyridin-1-ium-1-yl)sulfanylacetyl]-5-methyl-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate bromide |
| SMILES | CCOC(=O)C1(CCC(C)C)CC(C)(C(=O)CS[n+]2cc(Br)cc(Br)c2)OC1=O.[Br-] |
| InChI | InChI=1S/C20H26Br2NO5S.BrH/c1-5-27-17(25)20(7-6-13(2)3)12-19(4,28-18(20)26)16(24)11-29-23-9-14(21)8-15(22)10-23;/h8-10,13H,5-7,11-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KNWWVFJFGYMUOB-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|