C20H26N2O4S — CID 3125315
ethyl 5-(1H-benzimidazol-2-ylsulfanylmethyl)-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate (PubChem CID 3125315) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is ethyl 5-(1H-benzimidazol-2-ylsulfanylmethyl)-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl 5-(1H-benzimidazol-2-ylsulfanylmethyl)-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 3125315 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | ethyl 5-(1H-benzimidazol-2-ylsulfanylmethyl)-3-(3-methylbutyl)-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)C1(CCC(C)C)CC(CSc2nc3ccccc3[nH]2)OC1=O |
| InChI | InChI=1S/C20H26N2O4S/c1-4-25-17(23)20(10-9-13(2)3)11-14(26-18(20)24)12-27-19-21-15-7-5-6-8-16(15)22-19/h5-8,13-14H,4,9-12H2,1-3H3,(H,21,22) |
| InChIKey | TUQCHRGLROOUSM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|